![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Culture and Settlement.pdf | 17-Jan-2008 11:49 | 97K | |
| Culture and settlement.html | 17-Jan-2008 11:49 | 72K | |
| Dreams Across Oceans.html | 17-Jan-2008 11:49 | 181K | |
| Hmong Postwar Identity Production.html | 17-Jan-2008 11:49 | 87K | |
| The Shaping of Traditions.html | 17-Jan-2008 11:49 | 172K | |
| WS_FTP.LOG | 17-Jan-2008 11:49 | 344 | |
| _vti_cnf/ | 17-Jan-2008 11:49 | - | |
| culturecontents.html | 17-Jan-2008 11:49 | 23K | |
| hmong marriage.html | 17-Jan-2008 11:49 | 68K | |
| hmong world view and social structure.html | 17-Jan-2008 11:49 | 71K | |
| white hmong kinship terminology.html | 17-Jan-2008 11:49 | 79K | |